CAS 29479-00-3: Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-, methyl ester, hydrochloride (1:1), (5α,12R,19α)-
Description:Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-, methyl ester, hydrochloride (1:1), (5α,12R,19α)- is a chemical compound that belongs to the class of alkaloids, specifically derived from the Aspidosperma genus of plants. This compound is characterized by its complex structure, which includes a tetradehydro configuration and a methyl ester functional group, contributing to its unique chemical properties. The hydrochloride form indicates that it is a salt, which often enhances its solubility in water and stability. Alkaloids like this one are known for their diverse biological activities, including potential pharmacological effects. The presence of specific stereochemistry, denoted by the (5α,12R,19α)- notation, suggests that the compound exhibits chirality, which can influence its interaction with biological systems. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmacology, particularly in the exploration of natural products for therapeutic applications.
Formula:C21H24N2O2·ClH
InChI:InChI=1S/C21H24N2O2.ClH/c1-3-20-9-6-11-23-12-10-21(19(20)23)15-7-4-5-8-16(15)22-17(21)14(13-20)18(24)25-2;/h4-9,19,22H,3,10-13H2,1-2H3;1H/t19-,20-,21-;/m0./s1
InChI key:InChIKey=BBASQSWPQOKOQI-OCIDDWSYSA-N
SMILES:Cl.O=C(OC)C1=C2NC=3C=CC=CC3C24CCN5CC=CC(C1)(CC)C54
- Synonyms:
- Tabersonine, monohydrochloride
- Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-, methyl ester, hydrochloride (1:1), (5α,12R,19α)-
- Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-, methyl ester, monohydrochloride, (5α,12β,19α)-
- Tabersonine hydrochloride
- Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-, methyl ester, monohydrochloride, (5α,12R,19α)-
