CAS 29480-18-0
:2-Phenyl-2-adamantanol
Description:
2-Phenyl-2-adamantanol is an organic compound characterized by its unique structure, which features an adamantane core substituted with a phenyl group and a hydroxyl (-OH) functional group. This compound belongs to the class of alcohols and is known for its chiral center, leading to the existence of enantiomers. The presence of the bulky adamantane structure contributes to its rigidity and steric hindrance, influencing its reactivity and interactions with other molecules. 2-Phenyl-2-adamantanol is typically a white crystalline solid at room temperature and is sparingly soluble in water, but more soluble in organic solvents. Its properties make it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a precursor for the synthesis of more complex molecules or as a potential therapeutic agent. Additionally, the compound's stability and unique structural features may lend themselves to applications in drug design and development.
Formula:C16H20O
InChI:InChI=1S/C16H20O/c17-16(13-4-2-1-3-5-13)14-7-11-6-12(9-14)10-15(16)8-11/h1-5,11-12,14-15,17H,6-10H2
SMILES:c1ccc(cc1)C1(C2CC3CC(C2)CC1C3)O
Synonyms:- 2-Phenyladamantan-2-Ol
- Tricyclo[3.3.1.1~3,7~]Decan-2-Ol, 2-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Phenyl-2-adamantanol
CAS:<p>2-Phenyl-2-adamantanol is a deuterated analog of 2-phenyl-2-adamantane (C 10 H 16 ) with an isotopic weight of 128. The FTIR spectra show the presence of a new peak at 1728 cm−1, which is attributed to C=O stretching vibrations in the hydroxyl group. The IR spectrum of 2-phenyl-2-adamantanol shows that it has an azide group and two hydrogen bonds. It also interacts competitively with carbachol, but does not interact with atropine. Preparative oriented crystallization was used to isolate this compound from benzene.</p>Formula:C16H20OPurity:Min. 95%Color and Shape:PowderMolecular weight:228.33 g/mol
