CAS 29481-27-4

2-Bromo-5-cyclopropylthiophene

Description:

2-Bromo-5-cyclopropylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the second position and a cyclopropyl group at the fifth position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is likely to be a liquid or solid at room temperature, depending on its specific formulation and purity. It is known for its potential applications in organic synthesis and materials science, particularly in the development of electronic materials and pharmaceuticals. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. Additionally, the cyclopropyl group can influence the compound's steric and electronic properties, affecting its reactivity and interactions with other molecules. As with many organobromine compounds, safety precautions should be taken due to potential toxicity and environmental concerns.

Formula: C₇H₇BrS

InChI: InChI=1S/C7H7BrS/c8-7-4-3-6(9-7)5-1-2-5/h3-5H,1-2H2

InChI key: InChIKey=MCJLFMXDMPIBFA-UHFFFAOYSA-N

SMILES: BrC=1SC(C2CC2)=CC1

Synonyms:

• Thiophene, 2-bromo-5-cyclopropyl-
• 2-Bromo-5-cyclopropylthiophene

2-Bromo-5-cyclopropylthiophene

CAS: 29481-27-4

Formula: C₇H₇BrS

Molecular weight: 203.0995

Ref: IN-DA01A1PF

2-Bromo-5-(cyclopropyl)thiophene

CAS: 29481-27-4

2-Bromo-5-(cyclopropyl)thiophene

Formula: C₇H₇BrS

Purity: ≥95%

Color and Shape: clear. very dark red/brown liquid

Molecular weight: 203.10g/mol

Ref: 54-OR40806

2-Bromo-5-(cyclopropyl)thiophene

CAS: 29481-27-4

2-Bromo-5-(cyclopropyl)thiophene is an anhydride that is part of a class of compounds called thiophenes. These compounds are used to attack nitryl groups, which are cations with a nitrogen atom in the +3 oxidation state. Nitration of 2-bromo-5-(cyclopropyl)thiophene produces 2-bromo-5-(cyclopropyl)thioaniline, which is used as a reagent for the synthesis of dyes and pharmaceuticals.

Formula: C₇H₇BrS

Purity: Min. 95%

Molecular weight: 203.1 g/mol

Ref: 3D-EBA48127