CAS 294857-70-8
:α-Hydroxy-6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetic acid
Description:
α-Hydroxy-6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetic acid, with the CAS number 294857-70-8, is a chemical compound that belongs to the class of imidazopyridines. This substance features a complex structure characterized by an imidazole ring fused to a pyridine ring, along with a hydroxyl group and an acetic acid moiety. The presence of the 4-methylphenyl group contributes to its hydrophobic characteristics, which may influence its solubility and biological activity. Typically, compounds of this nature may exhibit various pharmacological properties, potentially including anti-inflammatory or analgesic effects, although specific biological activities would depend on further empirical studies. The compound's molecular structure suggests it may engage in hydrogen bonding due to the hydroxyl group, which can affect its interactions with biological targets. Additionally, the presence of multiple functional groups may allow for diverse reactivity and potential applications in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be reviewed prior to use.
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-10-3-6-12(7-4-10)14-15(16(20)17(21)22)19-9-11(2)5-8-13(19)18-14/h3-9,16,20H,1-2H3,(H,21,22)
InChI key:InChIKey=IWIKSBZMTWJGGC-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(N=C2N1C=C(C)C=C2)C3=CC=C(C)C=C3
Synonyms:- α-Hydroxy-6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetic acid
- Imidazo[1,2-a]pyridine-3-acetic acid, α-hydroxy-6-methyl-2-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
