CymitQuimica logo

CAS 29488-33-3

:

2-Thiophenecarboxylic acid, 3-cyclopropyl-

Description:
2-Thiophenecarboxylic acid, 3-cyclopropyl- is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, and a carboxylic acid functional group (-COOH) attached to the thiophene. The cyclopropyl group, a three-membered carbon ring, is substituted at the 3-position of the thiophene ring. This compound exhibits typical properties of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the thiophene ring contributes to its aromatic character and potential reactivity in electrophilic substitution reactions. Additionally, the cyclopropyl group can impart unique steric and electronic effects, potentially affecting the compound's reactivity and interaction with biological systems. Overall, 2-Thiophenecarboxylic acid, 3-cyclopropyl- is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential applications.
Formula:C8H8O2S
InChI:InChI=1S/C8H8O2S/c9-8(10)7-6(3-4-11-7)5-1-2-5/h3-5H,1-2H2,(H,9,10)
InChI key:InChIKey=WGKWJMSBCFTXSQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CS1)C2CC2
Synonyms:
  • 2-Thiophenecarboxylic acid, 3-cyclopropyl-
  • 3-Cyclopropylthiophene-2-carboxylic acid
Found 3 products.