CymitQuimica logo

CAS 29489-04-1

:

4-bromo-1-[(4-methylphenyl)sulfonyl]-1,2,3,4-tetrahydro-5H-1-benzazepin-5-one

Description:
4-bromo-1-[(4-methylphenyl)sulfonyl]-1,2,3,4-tetrahydro-5H-1-benzazepin-5-one is a chemical compound characterized by its complex structure, which includes a benzazepine core, a bromine substituent, and a sulfonyl group attached to a methylphenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the bromine atom introduces halogen characteristics, which can influence its reactivity and solubility in various solvents. The sulfonyl group enhances the compound's potential for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the tetrahydro configuration suggests that it may exhibit specific stereochemical properties, which can affect its biological activity. Overall, this compound's unique structural features contribute to its potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors and the presence of other functional groups.
Formula:C17H16BrNO3S
InChI:InChI=1/C17H16BrNO3S/c1-12-6-8-13(9-7-12)23(21,22)19-11-10-15(18)17(20)14-4-2-3-5-16(14)19/h2-9,15H,10-11H2,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)N1CCC(C(=O)c2ccccc12)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.