CAS 29526-99-6
:1-Methyl-1-cyclopropanol
Description:
1-Methyl-1-cyclopropanol is an organic compound characterized by its cyclopropane ring structure with a methyl group and a hydroxyl group attached to the same carbon atom, making it a tertiary alcohol. Its molecular formula is C4H8O, indicating it contains four carbon atoms, eight hydrogen atoms, and one oxygen atom. This compound is typically a colorless liquid with a distinctive odor, and it is known for its reactivity due to the strained cyclopropane ring, which can undergo various chemical transformations. 1-Methyl-1-cyclopropanol is soluble in organic solvents and has limited solubility in water. It is often used in organic synthesis and may serve as an intermediate in the production of other chemical compounds. The presence of the hydroxyl group contributes to its polar nature, influencing its interactions and reactivity in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H8O
InChI:InChI=1S/C4H8O/c1-4(5)2-3-4/h5H,2-3H2,1H3
InChI key:NCTCZGRRDXIGIY-UHFFFAOYSA-N
SMILES:CC1(CC1)O
Synonyms:- Cyclopropanol, 1-methyl-
- 1-Methylcyclopropanol
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Methylcyclopropanol
CAS:1-MethylcyclopropanolFormula:C4H8OPurity:85%Color and Shape:LiquidMolecular weight:72.1071-Methylcyclopropanol
CAS:1-Methylcyclopropanol is a multigram chemical that can be produced on a large scale. It is an organic compound with the molecular formula CH3CCH2OH. It can be synthesized from monomers such as cyclobutanone, amines, and hydrogen bond by ring-opening polymerization to produce polycyclohexane rings. 1-Methylcyclopropanol has been used in the synthesis of polymers such as poly(1-methylcyclopropane). This chemical has also been investigated for use in laser ablation techniques that remove material from surfaces and in laser cutting techniques that cut materials into shapes. 1-Methylcyclopropanol has been found to react with hypobromous acid to form a diol ether product.Formula:C4H8OPurity:80%MinColor and Shape:Clear LiquidMolecular weight:72.11 g/mol




