CymitQuimica logo

CAS 29527-27-3

:

5-(4-chlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol

Description:
5-(4-Chlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol, with the CAS number 29527-27-3, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This particular triazole derivative features a thiol (-SH) functional group, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the 4-chlorophenyl group enhances its biological activity and may influence its interaction with biological targets. The compound is typically characterized by its solid-state properties, solubility in organic solvents, and stability under standard laboratory conditions. Its thiol group can participate in redox reactions and form disulfides, making it a valuable building block in synthetic chemistry. Additionally, compounds of this nature may exhibit antimicrobial, antifungal, or herbicidal properties, making them of interest in medicinal and agricultural research. Safety and handling precautions should be observed due to the potential toxicity associated with thiol-containing compounds.
Formula:C9H8ClN3S
InChI:InChI=1/C9H8ClN3S/c1-13-8(11-12-9(13)14)6-2-4-7(10)5-3-6/h2-5H,1H3,(H,12,14)
InChI key:HAWRMYDVPCGDJW-UHFFFAOYSA-N
SMILES:Cn1c(c2ccc(cc2)Cl)nnc1S
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 5-(4-chlorophenyl)-2,4-dihydro-4-methyl-
  • 4H-1,2,4-triazole-3-thiol, 5-(4-chlorophenyl)-4-methyl-
Found 3 products.