CAS 295328-85-7
:(2S,5S)-2,5-diphenylpyrrolidine
Description:
(2S,5S)-2,5-diphenylpyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered cyclic amine. The presence of two phenyl groups at the 2 and 5 positions of the pyrrolidine structure contributes to its unique properties, including increased steric bulk and potential for specific interactions in biological systems. This compound exhibits chirality, meaning it exists in two enantiomeric forms, which can have different biological activities and reactivities. The specific stereochemistry indicated by the (2S,5S) configuration suggests that it has a defined spatial arrangement that can influence its interactions with other molecules, particularly in pharmaceutical applications. Additionally, (2S,5S)-2,5-diphenylpyrrolidine may exhibit solubility in organic solvents and could participate in various chemical reactions typical of amines, such as nucleophilic substitutions or formation of salts. Its unique structure and properties make it of interest in fields such as medicinal chemistry and materials science.
Formula:C16H17N
InChI:InChI=1/C16H17N/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15-,16-/m0/s1
SMILES:c1ccc(cc1)[C@@H]1CC[C@@H](c2ccccc2)N1
Synonyms:- pyrrolidine, 2,5-diphenyl-, (2S,5S)-
- (2S,5S)-2,5-Diphenylpyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrrolidine, 2,5-diphenyl-, (2S,5S)-
CAS:Formula:C16H17NPurity:97%Color and Shape:SolidMolecular weight:223.3129(2S,5S)-2,5-Diphenylpyrrolidine
CAS:(2S,5S)-2,5-DiphenylpyrrolidinePurity:97%Molecular weight:223.32g/mol(2S,5S)-2,5-Diphenylpyrrolidine
CAS:(2S,5S)-2,5-Diphenylpyrrolidine (2,5-DPP) is a chiral building block that can be used in the synthesis of a variety of structures. It has been shown to be useful for organocatalytic asymmetric synthesis and for the catalytic asymmetric cyanosilylation of amines and aldehydes. 2,5-DPP has also been used as a catalyst in stereoselective transformations involving thioethers and cyclic compounds. This compound is readily available to purchase online.Formula:C16H17NPurity:Min. 95%Color and Shape:White PowderMolecular weight:223.31 g/mol



