CAS 295360-83-7

1-[(5-bromo-2-methoxyphenyl)sulfonyl]piperidine

Description:

1-[(5-bromo-2-methoxyphenyl)sulfonyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing ring. The compound features a sulfonyl group attached to the piperidine, which enhances its reactivity and solubility in various solvents. The presence of a 5-bromo-2-methoxyphenyl group contributes to its biological activity and potential applications in medicinal chemistry. The bromine atom introduces a halogen, which can influence the compound's electronic properties and reactivity, while the methoxy group can enhance lipophilicity and affect the compound's interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure suggests potential applications in areas such as anti-inflammatory or anti-cancer therapies, although specific biological activities would need to be confirmed through experimental studies. As with many sulfonamide derivatives, it may also exhibit unique interactions with enzymes or receptors, warranting investigation into its mechanism of action.

Formula: C₁₂H₁₆BrNO₃S

InChI: InChI=1/C12H16BrNO3S/c1-17-11-6-5-10(13)9-12(11)18(15,16)14-7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3

SMILES: COc1ccc(cc1S(=O)(=O)N1CCCCC1)Br

Synonyms:

• 1-(5-Bromo-2-methoxy-benzenesulfonyl)-piperidine
• Piperidine, 1-[(5-Bromo-2-Methoxyphenyl)Sulfonyl]-
• 1-[(5-Bromo-2-methoxyphenyl)sulfonyl]piperidine

1-(5-Bromo-2-methoxyphenylsulfonyl)piperidine

CAS: 295360-83-7

Formula: C₁₂H₁₆BrNO₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 334.2293

Ref: IN-DA002YO9

4-Bromo-2-(piperidin-1-ylsulphonyl)anisole

CAS: 295360-83-7

4-Bromo-2-(piperidin-1-ylsulphonyl)anisole

Purity: 98%

Molecular weight: 334.23g/mol

Ref: 54-OR9412

1-((5-Bromo-2-methoxyphenyl)sulfonyl)piperidine

CAS: 295360-83-7

Purity: 98%

Molecular weight: 334.230011

Ref: 10-F772569