CAS 29540-87-2: Benzimidazole-1,2-diamine

Description:Benzimidazole-1,2-diamine, also known as o-phenylenediamine benzimidazole, is an organic compound characterized by its fused benzimidazole and diamine structure. It typically appears as a white to off-white solid and is soluble in water and various organic solvents. This compound is notable for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive molecules. It exhibits properties such as being a potential antioxidant and has been studied for its role in biological systems, including its effects on cellular processes. The presence of both amine and benzimidazole functional groups allows for diverse reactivity, making it a valuable building block in organic synthesis. Additionally, benzimidazole derivatives are known for their antimicrobial and antifungal activities, contributing to ongoing research in medicinal chemistry. Safety data indicates that, like many amines, it should be handled with care due to potential health hazards, including skin and respiratory irritation.

Formula:C₇H₈N₄

InChI:InChI=1S/C7H8N4/c8-7-10-5-3-1-2-4-6(5)11(7)9/h1-4H,9H2,(H2,8,10)

InChI key:InChIKey=JPVWRXBVNNXNND-UHFFFAOYSA-N

SMILES:N1=C(N)N(N)C=2C=CC=CC12

Synonyms:
Benzimidazole, 1,2-diamino-
1,2-Diaminobenzimidazole
NSC 286695
1H-Benzimidazole-1,2-diamine
Benzimidazole-1,2-diamine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-Benzimidazole-1,2-diamine REF: IN-DA002YP3CAS: 29540-87-2	95%	To inquire	Thu 17 Apr 25
Benzimidazole-1,2-diamine REF: 54-OR85634CAS: 29540-87-2	95%	269.00 €~445.00 €	Mon 21 Apr 25
Benzimidazole-1,2-diamine REF: 10-F718744CAS: 29540-87-2	97%	To inquire	Tue 29 Apr 25
1H-Benzimidazole-1,2-diamine REF: 3D-FB161417CAS: 29540-87-2	Min. 95%	- - -	Discontinued product