
CAS 29548-14-9
:p-Menth-1-en-9-al
Description:
p-Menth-1-en-9-al, also known as p-menth-1-en-9-al, is a monoterpenoid aldehyde characterized by its distinct structure derived from the menthol family. It features a cyclohexane ring with a double bond and an aldehyde functional group, contributing to its reactivity and potential applications in various fields. This compound is typically colorless to pale yellow and possesses a strong, minty aroma, making it valuable in the fragrance and flavor industries. p-Menth-1-en-9-al is known for its antimicrobial and antifungal properties, which can be beneficial in food preservation and cosmetic formulations. Additionally, it may exhibit biological activities, including potential therapeutic effects, although further research is necessary to fully understand its pharmacological profile. Its solubility in organic solvents and limited solubility in water are important characteristics for its use in formulations. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in industrial or laboratory settings.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c1-8-3-5-10(6-4-8)9(2)7-11/h3,7,9-10H,4-6H2,1-2H3
InChI key:InChIKey=UMEJBWOWZDRULR-UHFFFAOYSA-N
SMILES:C(C=O)(C)C1CCC(C)=CC1
Synonyms:- 1-p-Menthen-9-al
- 2-(4-Methylcyclohex-3-en-1-yl)propanal
- α,4-Dimethyl-3-cyclohexene-1-acetaldehyde
- p-Menth-1-en-9-al
- 3-Cyclohexene-1-acetaldehyde, α,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
