CAS 29552-52-1

4-ethyl-5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol

Description:

4-Ethyl-5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethyl group and a 4-fluorophenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the thiol (-SH) functional group enhances its reactivity, making it a candidate for various applications, including as a potential pharmaceutical agent or in agricultural chemistry. The fluorine atom in the phenyl ring can influence the compound's lipophilicity and biological interactions. Additionally, the compound may exhibit specific solubility characteristics, stability under various conditions, and potential for forming complexes with metal ions. Its CAS number, 29552-52-1, allows for easy identification in chemical databases and literature. Overall, this compound's structural features suggest it may possess interesting pharmacological properties, warranting further investigation in medicinal chemistry and related fields.

Formula: C₁₀H₁₀FN₃S

InChI: InChI=1/C10H10FN3S/c1-2-14-9(12-13-10(14)15)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3,(H,13,15)

SMILES: CCn1c(c2ccc(cc2)F)nnc1S

Synonyms:

• 4H-1,2,4-Triazole-3-thiol, 4-ethyl-5-(4-fluorophenyl)-
• 4-Ethyl-5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol

4-Ethyl-5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol

CAS: 29552-52-1

Formula: C₁₀H₁₀FN₃S

Molecular weight: 223.2699

Ref: IN-DA002YQJ

4-Ethyl-5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol

CAS: 29552-52-1

4-Ethyl-5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol

Purity: ≥95%

Molecular weight: 223.27g/mol

Ref: 54-PC10586