CymitQuimica logo

CAS 29553-26-2

:

3,3,4,4-Tetrafluoro-2-methyl-2-butanol

Description:
3,3,4,4-Tetrafluoro-2-methyl-2-butanol is a fluorinated alcohol characterized by the presence of four fluorine atoms and a hydroxyl group (-OH) attached to a branched carbon chain. This compound features a tertiary alcohol structure, which typically influences its reactivity and solubility properties. The presence of fluorine atoms imparts unique characteristics, such as increased hydrophobicity and potential thermal stability, making it of interest in various applications, including as a solvent or in the synthesis of fluorinated compounds. The molecular structure contributes to its physical properties, such as boiling point and viscosity, which may differ significantly from non-fluorinated alcohols. Additionally, the compound's fluorinated nature may enhance its resistance to oxidation and degradation, making it suitable for use in specialized chemical processes. Safety data sheets should be consulted for handling and toxicity information, as fluorinated compounds can exhibit unique environmental and health impacts. Overall, 3,3,4,4-Tetrafluoro-2-methyl-2-butanol represents a specialized class of chemicals with distinct properties and potential applications in various fields.
Formula:C5H8F4O
InChI:InChI=1/C5H8F4O/c1-4(2,10)5(8,9)3(6)7/h3,10H,1-2H3
InChI key:InChIKey=NCMPMCXQKBZXGI-UHFFFAOYSA-N
SMILES:C(C(C)(C)O)(C(F)F)(F)F
Synonyms:
  • NSC 86110
  • 2,2,3,3-Tetrafluoro-1,1-dimethylpropanol
  • 2-Methyl-3,3,4,4-tetrafluoro-2-butanol
  • 3,3,4,4-Tetrafluoro-2-methyl-2-butanol
  • 2-Butanol, 3,3,4,4-tetrafluoro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.