CAS 29553-51-3
:3-Methyl-2,6-piperidinedione
Description:
3-Methyl-2,6-piperidinedione, also known as 3-methyl-2,6-piperidinedione or simply as a derivative of piperidine, is a cyclic organic compound characterized by its piperidine ring structure with two carbonyl groups at the 2 and 6 positions and a methyl group at the 3 position. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure contributes to its potential reactivity, particularly in forming derivatives through nucleophilic addition reactions due to the presence of the carbonyl groups. 3-Methyl-2,6-piperidinedione may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and purity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c1-4-2-3-5(8)7-6(4)9/h4H,2-3H2,1H3,(H,7,8,9)
InChI key:InChIKey=DKCRDQKHMMPWPG-UHFFFAOYSA-N
SMILES:O=C1C(C)CCC(=O)N1
Synonyms:- 2-Methylglutarimide
- 2,6-Piperidinedione, 3-methyl-
- 3-Methyl-2,6-piperidinedione
- 3-Methylglutazine
- Glutarimide, 2-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Piperidinedione, 3-methyl-
CAS:Formula:C6H9NO2Purity:95%Color and Shape:SolidMolecular weight:127.14123-Methylpiperidine-2,6-dione
CAS:Formula:C6H9NO2Purity:95.0%Color and Shape:SolidMolecular weight:127.1433-Methylpiperidine-2,6-dione
CAS:3-Methylpiperidine-2,6-dione is a dipeptide that is used to form an oral drug delivery system. It is encapsulated in silicone and has affinity for hydrogen peroxide. A heterostructure is created by sandwiching the 3-methylpiperidine-2,6-dione between two layers of acrylate. This creates a device that can be activated by light and will release the dipeptide when it reaches a specific pH level. The acrylates are dissolved in an oxocarboxylic acid, which also denatures the peptide to prevent proteolysis by enzymes in the stomach. Once it reaches the small intestine, the phthalimides are cleaved from the 3-methylpiperidine-2,6-dione, leaving behind an intact dipeptide.Formula:C6H9NO2Purity:Min. 95%Molecular weight:127.14 g/mol



