CAS 29570-45-4

Sodium phenylphosphinate

Description:

Sodium phenylphosphinate is an inorganic compound with the chemical formula C6H6NaO2P. It is characterized by the presence of a phenyl group attached to a phosphinate moiety, which contributes to its unique properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water, making it useful in various applications. Sodium phenylphosphinate is often utilized as a flame retardant in plastics and polymers due to its ability to enhance thermal stability and reduce flammability. Additionally, it can serve as a stabilizer in certain chemical processes. The compound exhibits low toxicity, which makes it a safer alternative compared to other flame retardants. Its reactivity is influenced by the phosphinate group, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution. Overall, sodium phenylphosphinate is valued for its functional properties in materials science and its relatively benign environmental profile.

Formula: C₆H₇O₂P·Na

InChI: InChI=1S/C6H7O2P.Na/c7-9(8)6-4-2-1-3-5-6;/h1-5,9H,(H,7,8);

InChI key: InChIKey=NXOIWSPUTXWQSM-UHFFFAOYSA-N

SMILES: P(=O)(O)C1=CC=CC=C1.[Na]

Synonyms:

• Phosphinic acid, P-phenyl-, sodium salt (1:1)
• Phenylphosphinic acid, sodium salt
• Sodium benzenephosphinate
• Phosphinic acid, phenyl-, monosodium salt
• Sodium phenylphosphinate