CymitQuimica logo

CAS 29576-66-7

:

(4E,6E,12E)-Tetradecatriene-8,10-diyne-1,3-diyl diacetate

Description:
(4E,6E,12E)-Tetradecatriene-8,10-diyne-1,3-diyl diacetate, with the CAS number 29576-66-7, is a complex organic compound characterized by its unique structure, which includes multiple double and triple bonds, specifically in the form of conjugated systems. This compound features a tetradecatriene backbone, indicating it has a total of 14 carbon atoms with three double bonds, and two acetyloxy groups (-OCOCH3) that contribute to its diacetate designation. The presence of these functional groups suggests that it may exhibit reactivity typical of esters, such as hydrolysis or transesterification. The specific geometric isomerism (4E, 6E, 12E) indicates the configuration of the double bonds, which can influence the compound's physical properties, such as boiling point and solubility. Additionally, the presence of multiple unsaturations may impart interesting optical and electronic properties, making it potentially useful in various applications, including organic synthesis and materials science. However, detailed studies would be necessary to fully understand its reactivity and potential uses.
Formula:C18H20O4
InChI:InChI=1/C18H20O4/c1-4-5-6-7-8-9-10-11-12-13-18(22-17(3)20)14-15-21-16(2)19/h4-5,10-13,18H,14-15H2,1-3H3/b5-4+,11-10+,13-12+
InChI key:InChIKey=PGHCYQUSYHWJAI-NOPLWHKLNA-N
SMILES:C(CCOC(C)=O)(/C=C/C=C/C#CC#C/C=C/C)OC(C)=O
Synonyms:
  • 4,6,12-Tetradecatriene-8,10-diyne-1,3-diol, diacetate, (4E,6E,12E)-
  • (4E,6E,12E)-Tetradecatriene-8,10-diyne-1,3-diyl diacetate
  • 1,3-Diacetoxy-4-trans,6-trans,12-trans-tetradecatriene-8,10-diyne
  • 4,6,12-Tetradecatriene-8,10-diyne-1,3-diol, diacetate, (E,E,E)-
  • 4,6,12-Tetradecatriene-8,10-diyne-1,3-diol, 1,3-diacetate, (4E,6E,12E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.