CAS 2958-75-0

Decahydro-1-methylnaphthalene

Description:

Decahydro-1-methylnaphthalene, with the CAS number 2958-75-0, is a bicyclic organic compound that belongs to the class of saturated polycyclic hydrocarbons. It is derived from naphthalene, featuring a saturated structure with ten hydrogen atoms and a methyl group attached to one of the naphthalene rings. This compound is typically colorless and has a characteristic odor reminiscent of naphthalene. It is insoluble in water but soluble in organic solvents, making it useful in various applications, including as a solvent and in the formulation of fragrances. Decahydro-1-methylnaphthalene exhibits a relatively high boiling point and low volatility compared to its unsaturated counterparts, which contributes to its stability under standard conditions. Additionally, it is considered to have low toxicity, although safety precautions should still be observed when handling it. Its chemical structure allows for potential applications in the synthesis of other organic compounds and materials in the chemical industry.

Formula: C₁₁H₂₀

InChI: InChI=1S/C11H20/c1-9-5-4-7-10-6-2-3-8-11(9)10/h9-11H,2-8H2,1H3

InChI key: InChIKey=NHCREQREVZBOCH-UHFFFAOYSA-N

SMILES: CC1C2C(CCC1)CCCC2

Synonyms:

• Naphthalene, decahydro-1-methyl-
• Decahydro-1-methylnaphthalene
• 1-Methyldecalin
• 1-Methyldecahydronaphthalene