CAS 295803-26-8

4-Bromo-1-(dibromomethyl)-2-fluorobenzene

Description:

4-Bromo-1-(dibromomethyl)-2-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various halogen atoms. Specifically, it features a bromine atom at the para position relative to a dibromomethyl group and a fluorine atom at the ortho position. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. The presence of multiple halogen substituents can influence its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the halogen substituents, which can enhance its lipophilicity and alter its interaction with biological systems. Safety considerations should be taken into account due to the toxicity associated with halogenated compounds. Overall, 4-Bromo-1-(dibromomethyl)-2-fluorobenzene represents a complex structure with diverse chemical behavior and potential utility in synthetic chemistry.

Formula: C₇H₄Br₃F

InChI: InChI=1S/C7H4Br3F/c8-4-1-2-5(7(9)10)6(11)3-4/h1-3,7H

InChI key: InChIKey=IWJXZHAXIPORHB-UHFFFAOYSA-N

SMILES: C(Br)(Br)C1=C(F)C=C(Br)C=C1

Synonyms:

• 4-Bromo-2-fluorobenzal bromide
• Benzene, 4-Bromo-1-(Dibromomethyl)-2-Fluoro-
• 4-Bromo-1-(dibromomethyl)-2-fluorobenzene

4-bromo-1-(dibromomethyl)-2-fluorobenzene

CAS: 295803-26-8

Formula: C₇H₄Br₃F

Color and Shape: Solid

Molecular weight: 346.8171

Ref: IN-DA002YSZ

4-BROMO-1-(DIBROMOMETHYL)-2-FLUOROBENZENE

CAS: 295803-26-8

Formula: C₇H₄Br₃F

Purity: 95.0%

Molecular weight: 346.819

Ref: 10-F500403