CAS 2959-04-8
:2-(4,6-diamino-1,3,5-triazin-2-yl)guanidine
Description:
2-(4,6-Diamino-1,3,5-triazin-2-yl)guanidine, with the CAS number 2959-04-8, is a chemical compound that features a triazine ring substituted with amino groups and a guanidine moiety. This compound is characterized by its high nitrogen content, which contributes to its potential applications in various fields, including agriculture as a herbicide or plant growth regulator. The presence of multiple amino groups enhances its reactivity and solubility in polar solvents. It typically exhibits good thermal stability, making it suitable for formulations that require heat resistance. Additionally, the compound may display biological activity, which can be explored for pharmaceutical applications. Its structure allows for hydrogen bonding and interactions with biological macromolecules, potentially influencing its efficacy in biological systems. Overall, 2-(4,6-diamino-1,3,5-triazin-2-yl)guanidine is a versatile compound with significant implications in both chemical and biological research.
Formula:C4H8N8
InChI:InChI=1/C4H8N8/c5-1(6)9-4-11-2(7)10-3(8)12-4/h(H8,5,6,7,8,9,10,11,12)
SMILES:C(=N)(N)N=c1[nH]c(=N)[nH]c(=N)[nH]1
Synonyms:- 1-(4,6-Diamino-1,3,5-Triazin-2-Yl)Guanidine
- guanidine, N-(4,6-diamino-1,3,5-triazin-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
