CymitQuimica logo

CAS 29604-19-1

:

1-Piperazinesulfonamide,4-methyl-

Description:
1-Piperazinesulfonamide, 4-methyl- is a chemical compound characterized by its piperazine ring structure, which is a six-membered cyclic amine featuring two nitrogen atoms. This compound contains a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to a nitrogen atom. The methyl group at the 4-position of the piperazine ring contributes to its unique properties and reactivity. Typically, sulfonamides exhibit antibacterial activity and can interact with various biological targets, making them of interest in medicinal chemistry. The presence of the piperazine moiety often enhances solubility and bioavailability. This compound may also exhibit properties such as moderate to high polarity, depending on the specific substituents and their arrangement. Its applications could range from pharmaceuticals to agrochemicals, although specific uses would depend on further research and development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C5H13N3O2S
InChI:InChI=1S/C5H13N3O2S/c1-7-2-4-8(5-3-7)11(6,9)10/h2-5H2,1H3,(H2,6,9,10)
InChI key:NMAOAFBQWWLHQG-UHFFFAOYSA-N
SMILES:CN1CCN(CC1)S(=O)(=O)N
Synonyms:
  • 1-Methyl-4-sulfonamidopiperazine
  • 4-Methylpiperazine-1-sulfonamide
  • N-Sulfamoyl-N'-methylpiperazine
Found 4 products.