CAS 2961-04-8
:1,4,5-trihydroxyanthraquinone
Description:
1,4,5-Trihydroxyanthraquinone, with the CAS number 2961-04-8, is an organic compound belonging to the anthraquinone family, characterized by its three hydroxyl (-OH) groups located at the 1, 4, and 5 positions of the anthraquinone structure. This compound typically appears as a dark red to brown solid and is known for its solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. It exhibits significant chemical reactivity, particularly in redox reactions, due to the presence of the hydroxyl groups, which can participate in hydrogen bonding and influence its chemical behavior. 1,4,5-Trihydroxyanthraquinone is often utilized in various applications, including as a dye precursor, in the synthesis of other organic compounds, and in research related to its potential biological activities, such as antimicrobial and anticancer properties. Its structural features contribute to its ability to interact with biological systems, making it a subject of interest in medicinal chemistry and materials science.
Formula:C14H8O5
InChI:InChI=1S/C14H8O5/c15-7-3-1-2-6-10(7)14(19)12-9(17)5-4-8(16)11(12)13(6)18/h1-5,15-17H
InChI key:InChIKey=PRKNCOCERFKSLP-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(O)C=CC3)=C(O)C=CC2O
Synonyms:- 1,4,5-Trihydroxy-9,10-anthracenedione
- 1,4,5-Trihydroxy-9,10-anthraquinone
- 1,4,5-Trihydroxyanthracene-9,10-Dione
- 1,4,8-Trihydroxyanthraquinone
- 5-Hydroxyquinizarin
- 9,10-Anthracenedione, 1,4,5-trihydroxy-
- Anthraquinone, 1,4,5-trihydroxy-
- NSC 37591
- 1,4,5-Trihydroxyanthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
