CymitQuimica logo

CAS 2961-48-0

:

3-(nonan-5-yl)pyridine

Description:
3-(Nonan-5-yl)pyridine, with the CAS number 2961-48-0, is an organic compound characterized by a pyridine ring substituted with a nonyl group at the 3-position. Pyridine is a six-membered aromatic heterocycle containing one nitrogen atom, which imparts basic properties to the compound. The nonyl group, derived from nonane, is a long-chain alkyl group that contributes to the hydrophobic characteristics of the molecule. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. The presence of the nitrogen atom in the pyridine ring can also influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, compounds like 3-(nonan-5-yl)pyridine may have applications in organic synthesis, pharmaceuticals, or as intermediates in the production of more complex molecules. Its physical properties, such as boiling point and melting point, would depend on the specific structure and interactions of the molecule.
Formula:C14H23N
InChI:InChI=1/C14H23N/c1-3-5-8-13(9-6-4-2)14-10-7-11-15-12-14/h7,10-13H,3-6,8-9H2,1-2H3
SMILES:CCCCC(CCCC)c1cccnc1
Synonyms:
  • Pyridine, 3-(1-butylpentyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.