CymitQuimica logo

CAS 2961-76-4

:

anthracen-9-ylacetonitrile

Description:
Anthracen-9-ylacetonitrile, with the CAS number 2961-76-4, is an organic compound characterized by its structure, which features an anthracene moiety linked to an acetonitrile group. This compound typically appears as a crystalline solid and is known for its aromatic properties due to the presence of the anthracene structure, which consists of three fused benzene rings. Anthracen-9-ylacetonitrile is often utilized in organic synthesis and materials science, particularly in the development of organic semiconductors and fluorescent materials. Its chemical properties include moderate solubility in organic solvents, and it may exhibit photoluminescent behavior, making it of interest in optoelectronic applications. Additionally, the presence of the nitrile functional group contributes to its reactivity, allowing for various chemical transformations. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, anthracen-9-ylacetonitrile is a valuable compound in research and industrial applications.
Formula:C16H11N
InChI:InChI=1/C16H11N/c17-10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16/h1-8,11H,9H2
InChI key:MUTCNFLGBMSLTA-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)cc1ccccc1c2CC#N
Synonyms:
  • 9-Anthraceneacetonitrile
Found 4 products.