CAS 29619-45-2
:6,6'-dimethoxy-2,2'-binaphthalene
Description:
6,6'-Dimethoxy-2,2'-binaphthalene is an organic compound characterized by its structure, which consists of two naphthalene units connected by a central bond, with methoxy groups (-OCH3) attached to the 6 positions of each naphthalene ring. This compound is notable for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics due to its ability to facilitate charge transport. The presence of methoxy groups enhances its solubility in organic solvents and can influence its electronic properties, making it a subject of interest in materials science. Additionally, the compound exhibits chirality, which can be significant in asymmetric synthesis and in the development of chiral materials. Its molecular structure contributes to its optical properties, allowing for potential use in chiral sensors and other optoelectronic applications. As with many organic compounds, handling should be done with care, considering safety data and potential environmental impacts.
Formula:C22H18O2
InChI:InChI=1/C22H18O2/c1-23-21-9-7-17-11-15(3-5-19(17)13-21)16-4-6-20-14-22(24-2)10-8-18(20)12-16/h3-14H,1-2H3
SMILES:COc1ccc2cc(ccc2c1)c1ccc2cc(ccc2c1)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Nabumetone EP Impurity F
CAS:Controlled ProductFormula:C22H18O2Color and Shape:NeatMolecular weight:314.386,6'-Dimethoxy-2,2'-binaphthalene
CAS:Controlled Product<p>Applications 6,6'-Dimethoxy-2,2'-binaphthalene, can be used for the synthesis of novel classes of non-steroidal substrate mimetics, as inhibitors of human CYP17. It is also an impurity of Nabumetone (N200500), a non-steroidal anti-inflammatory drug, acting as anti-inflammatory agent.<br>References Kumpulainen, H., et al.: J. Med. Chem., 49, 1207 (2006); Pinto-Bazurco, M. A. E., et al.: Bioorg. Med. Chem. Lett., 18, 267 (2008);<br></p>Formula:C22H18O2Color and Shape:NeatMolecular weight:314.386,6-Dimethoxy-2,2-binaphthalene
CAS:<p>Please enquire for more information about 6,6-Dimethoxy-2,2-binaphthalene including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C22H18O2Purity:Min. 95%Molecular weight:314.4 g/mol







