CAS 29621-88-3: L-Selenocystine
Description:L-Selenocystine is an organoselenium compound that is a derivative of the amino acid cysteine, where the sulfur atom is replaced by selenium. It is characterized by its unique selenium-containing structure, which contributes to its biological activity and potential health benefits. L-Selenocystine is known for its antioxidant properties, which can help protect cells from oxidative stress. It plays a role in various biochemical processes, including the synthesis of selenoproteins, which are essential for maintaining cellular function and metabolism. This compound is often studied for its potential therapeutic applications, particularly in cancer research and as a dietary supplement due to its ability to influence immune response and promote overall health. Additionally, L-Selenocystine is soluble in water and exhibits stability under physiological conditions, making it a subject of interest in nutritional and pharmaceutical studies. Its CAS number, 29621-88-3, is used for identification in chemical databases and regulatory contexts.
Formula:C6H12N2O4Se2
InChI:InChI=1S/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1
InChI key:InChIKey=JULROCUWKLNBSN-IMJSIDKUSA-N
SMILES:O=C(O)C(N)C[Se][Se]CC(N)C(=O)O
- Synonyms:
- 3,3′-Diselenobis[<span class="text-smallcaps">L</span>-alanine]
- <span class="text-smallcaps">L</span>-Alanine, 3,3′-diselenobis-
- <span class="text-smallcaps">L</span>-Selenocystine
- Alanine, 3,3′-diselenodi-, <span class="text-smallcaps">L</span>-
- Alanine,3,3'-diselenodi-, L- (8CI)
- L-Selenocystine
- Selenocystine
- 3,3′-Diselenobis[L-alanine]
- L-Alanine, 3,3′-diselenobis-
- Alanine, 3,3′-diselenodi-, L-
- See more synonyms
