CAS 296276-42-1

4-(Difluoromethoxy)-N-methylbenzenemethanamine

Description:

4-(Difluoromethoxy)-N-methylbenzenemethanamine, with the CAS number 296276-42-1, is a chemical compound characterized by its unique molecular structure, which includes a difluoromethoxy group and a N-methylbenzene moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the difluoromethoxy group may enhance its lipophilicity and stability, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and its reactivity may be influenced by the electron-withdrawing nature of the difluoromethoxy group. Overall, 4-(Difluoromethoxy)-N-methylbenzenemethanamine represents a class of compounds that could have significant implications in pharmaceutical research and development.

Formula: C₉H₁₁F₂NO

InChI: InChI=1S/C9H11F2NO/c1-12-6-7-2-4-8(5-3-7)13-9(10)11/h2-5,9,12H,6H2,1H3

InChI key: InChIKey=OZLPONSQVQLJSI-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC=C(CNC)C=C1

Synonyms:

• 1-[4-(Difluoromethoxy)phenyl]-N-methylmethanamine
• [[4-(Difluoromethoxy)phenyl]methyl](methyl)amine
• 4-(Difluoromethoxy)-N-methylbenzenemethanamine
• (4-Difluoromethoxy-benzyl)-methyl-amine
• Benzenemethanamine, 4-(difluoromethoxy)-N-methyl-

Benzenemethanamine, 4-(difluoromethoxy)-N-methyl-

CAS: 296276-42-1

Formula: C₉H₁₁F₂NO

Purity: 97%

Molecular weight: 187.1865

Ref: IN-DA002YXT

{[4-(difluoromethoxy)phenyl]methyl}(methyl)amine

CAS: 296276-42-1

{[4-(difluoromethoxy)phenyl]methyl}(methyl)amine

Purity: 97%

Molecular weight: 187.19g/mol

Ref: 54-PC111794

{[4-(difluoromethoxy)phenyl]methyl}(methyl)amine

CAS: 296276-42-1

Purity: 97%

Molecular weight: 187.1900024

Ref: 10-F643429