CAS 2963-77-1

4-(1H-benzimidazol-2-yl)aniline

Description:

4-(1H-benzimidazol-2-yl)aniline, with the CAS number 2963-77-1, is an organic compound characterized by its dual functional groups: an aniline moiety and a benzimidazole ring. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and materials science due to its unique structural features. The presence of the benzimidazole ring contributes to its biological activity, often exhibiting properties such as antimicrobial or anticancer effects. The aniline part of the molecule provides basicity and can participate in various chemical reactions, including electrophilic substitutions. Its solubility can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. Additionally, the compound's molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₁N₃

InChI: InChI=1/C13H11N3/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H,14H2,(H,15,16)

SMILES: c1ccc2c(c1)[nH]c(c1ccc(cc1)N)n2

Synonyms:

• Benzenamine, 4-(1H-benzimidazol-2-yl)-
• 4-(1H-Benzimidazol-2-yl)aniline

Benzenamine, 4-(1H-benzimidazol-2-yl)-

CAS: 2963-77-1

Formula: C₁₃H₁₁N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 209.2465

Ref: IN-DA002YY5

4-(1H-Benzo[D]Imidazol-2-Yl)Aniline

CAS: 2963-77-1

4-(1H-Benzo[D]Imidazol-2-Yl)Aniline

Purity: 99%

Molecular weight: 209.25g/mol

Ref: 54-OR1011101

4-(1 H -Benzoimidazol-2-yl)-phenylamine

CAS: 2963-77-1

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 209.2519989013672

Ref: 10-F030018

4-(1H-Benzimidazol-2-yl)aniline

CAS: 2963-77-1

Formula: C₁₃H₁₁N₃

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 209.25

Ref: 3B-B5710