CAS 2963-78-2
:Butyrylcholine chloride
Description:
Butyrylcholine chloride is a quaternary ammonium compound that serves as a synthetic analog of the neurotransmitter acetylcholine. It is characterized by its ability to act as a cholinergic agonist, primarily influencing the peripheral nervous system. The compound is typically a white to off-white crystalline powder that is soluble in water, making it suitable for various biological applications. Its chemical structure includes a butyryl group attached to a choline moiety, which contributes to its activity at cholinergic receptors. Butyrylcholine chloride is often used in pharmacological research to study cholinergic signaling and has applications in the development of drugs targeting neurological disorders. Additionally, it is utilized in biochemical assays and as a substrate in enzyme studies, particularly involving cholinesterases. Safety data indicates that, like many quaternary ammonium compounds, it should be handled with care to avoid potential irritations or adverse effects. Overall, Butyrylcholine chloride is a valuable tool in both research and therapeutic contexts within the field of neurochemistry.
Formula:C9H20NO2·Cl
InChI:InChI=1S/C9H20NO2.ClH/c1-5-6-9(11)12-8-7-10(2,3)4;/h5-8H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=VCOBYGVZILHVOO-UHFFFAOYSA-M
SMILES:C([N+](C)(C)C)COC(CCC)=O.[Cl-]
Synonyms:- 2-(butanoyloxy)-N,N,N-trimethylethanaminium chloride
- 2-(butanoyloxy)-N,N,N-trimethylethanaminium chloride hydrate
- 2-Butyryloxyethyltrimethylammonium Chloride
- Butyric acid, ester with choline chloride
- Butyrylcholine chloride
- Choline, chloride, butyrate
- Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, chloride
- Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, chloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
[2-(butanoyloxy)ethyl]trimethylazanium chloride
CAS:Formula:C9H20ClNO2Purity:98%Color and Shape:SolidMolecular weight:209.71362-(Butyryloxy)-N,N,N-Trimethylethanaminium Chloride
CAS:2-(Butyryloxy)-N,N,N-Trimethylethanaminium ChloridePurity:98%Butyrylcholine chloride
CAS:Formula:C9H20ClNO2Purity:≥ 95.0%Color and Shape:White to off-white powder, crystals or solidMolecular weight:209.71Butyrylcholine chloride
CAS:Butyrylcholine chloride is a choline esterase inhibitor that binds to acetylcholine receptors, preventing the release of acetylcholine. This prevents the transmission of nerve impulses, which leads to an inhibition of brain functions. Butyrylcholine chloride has been shown to have inhibitory properties against signal peptide and target enzymes such as esterases and phospholipases. Butyrylcholine chloride also has a fluorescent probe that can be used for biological samples, such as enzyme activity in rat brain tissue. It is also used as pharmacological agents for treatment of Alzheimer's disease, myasthenia gravis, and other diseases involving cholinergic dysfunction.
Formula:C9H20ClNO2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:209.71 g/mol




