CAS 29632-82-4

5-bromo-1,2-benzisothiazol-3(2H)-one 1,1-dioxide

Description:

5-Bromo-1,2-benzisothiazol-3(2H)-one 1,1-dioxide, with the CAS number 29632-82-4, is a heterocyclic compound characterized by its benzisothiazole structure, which incorporates a bromine atom and a sulfonyl group. This compound typically appears as a solid and is known for its antimicrobial properties, making it useful in various applications, including as a preservative in cosmetics and personal care products. The presence of the bromine atom enhances its reactivity and biological activity. Its molecular structure contributes to its stability and solubility in organic solvents, while its functional groups allow for interactions with biological systems. Additionally, it is important to handle this compound with care due to potential toxicity and environmental concerns associated with its use. Overall, 5-bromo-1,2-benzisothiazol-3(2H)-one 1,1-dioxide is valued for its efficacy in preventing microbial growth, but safety measures should be observed during its application and handling.

Formula: C₇H₄BrNO₃S

InChI: InChI=1/C7H4BrNO3S/c8-4-1-2-6-5(3-4)7(10)9-13(6,11)12/h1-3H,(H,9,10)

SMILES: c1cc2c(cc1Br)C(=NS2(=O)=O)O

1,2-Benzisothiazol-3(2H)-One, 5-Bromo-, 1,1-Dioxide

CAS: 29632-82-4

Formula: C₇H₄BrNO₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 262.0806

Ref: IN-DA002YXU

5-Bromobenzo[d]isothiazol-3(2H)-one 1,1-dioxide

CAS: 29632-82-4

5-Bromobenzo[d]isothiazol-3(2H)-one 1,1-dioxide

Purity: 97%

Molecular weight: 262.08g/mol

Ref: 54-OR73684

5-Bromobenzo[d]isothiazol-3(2H)-one 1,1-dioxide

CAS: 29632-82-4

Purity: 95%

Molecular weight: 262.0799866

Ref: 10-F601463

5-Bromobenzo[d]isothiazol-3(2H)-one 1,1-dioxide

CAS: 29632-82-4

Versatile small molecule scaffold

Formula: C₇H₄BrNO₃S

Purity: Min. 95%

Molecular weight: 262.08 g/mol

Ref: 3D-EBA63282