CAS 29638-71-9

3-[(2E)-3-phenylprop-2-en-1-yl]pentane-2,4-dione

Description:

3-[(2E)-3-phenylprop-2-en-1-yl]pentane-2,4-dione, with the CAS number 29638-71-9, is an organic compound characterized by its diketone structure, featuring two carbonyl (C=O) groups located at the 2 and 4 positions of a pentane chain. The compound also contains a phenylprop-2-en-1-yl substituent at the 3-position, which introduces a conjugated double bond system, enhancing its reactivity and potential for various chemical transformations. This structure contributes to its potential applications in organic synthesis and as a building block in the development of pharmaceuticals or agrochemicals. The presence of the phenyl group can also influence the compound's physical properties, such as solubility and melting point, while the diketone functionality may impart unique reactivity, allowing for nucleophilic additions or condensation reactions. Overall, this compound exemplifies the complexity and versatility of organic molecules, particularly those containing multiple functional groups.

Formula: C₁₄H₁₆O₂

InChI: InChI=1/C14H16O2/c1-11(15)14(12(2)16)10-6-9-13-7-4-3-5-8-13/h3-9,14H,10H2,1-2H3/b9-6+

3-(3-phenyl-2-propenyl)-2,4-pentanedione

CAS: 29638-71-9

Formula: C₁₄H₁₆O₂

Molecular weight: 216.2756

Ref: IN-DA002YYG

3-[(2E)-3-Phenylprop-2-en-1-yl]pentane-2,4-dione

CAS: 29638-71-9

3-[(2E)-3-Phenylprop-2-en-1-yl]pentane-2,4-dione

Purity: 95%

Molecular weight: 216.28g/mol

Ref: 54-OR32675