CAS 2964-09-2
:Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, chloride (1:1)
Description:
Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, chloride (1:1), commonly referred to as a quaternary ammonium compound, is characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a trimethylated nitrogen, which contributes to its solubility in polar solvents and enhances its surfactant properties. The benzoyloxy group attached to the ethyl chain provides additional hydrophobic characteristics, making it useful in various applications, including as a surfactant or antimicrobial agent. The chloride ion serves as the counterion, stabilizing the cationic structure. This compound is typically used in formulations requiring antimicrobial activity, such as disinfectants or preservatives. Its quaternary structure allows for effective interaction with biological membranes, which can lead to cell disruption in microbial organisms. Safety considerations include potential irritancy and toxicity, necessitating careful handling and usage in accordance with safety guidelines. Overall, this compound exemplifies the functional versatility of quaternary ammonium compounds in both industrial and pharmaceutical applications.
Formula:C12H18NO2·Cl
InChI:InChI=1S/C12H18NO2.ClH/c1-13(2,3)9-10-15-12(14)11-7-5-4-6-8-11;/h4-8H,9-10H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=QVFHQENRNSAHEK-UHFFFAOYSA-M
SMILES:C(OCC[N+](C)(C)C)(=O)C1=CC=CC=C1.[Cl-]
Synonyms:- 2-(benzoyloxy)-N,N,N-trimethylethanaminium chloride
- Benzoylcholine chloride
- Choline, chloride, benzoate
- Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, chloride
- Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, chloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoylcholine Chloride
CAS:Formula:C12H18ClNO2Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:243.73Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, chloride (1:1)
CAS:Formula:C12H18ClNO2Purity:98%Color and Shape:SolidMolecular weight:243.7298Benzoylcholine chloride
CAS:<p>Benzoylcholine chloride is a versatile building block that can serve as a useful scaffold for the synthesis of complex compounds. It is also used in research and development as a reaction component and speciality chemical. Benzoylcholine chloride is an excellent reagent for the protection of amines and alcohols, making it an excellent high-quality building block.</p>Purity:Min. 95%Color and Shape:PowderMolecular weight:243.73 g/mol




