CAS 2964-81-0
:11-Dehydrodexamethasone
Description:
11-Dehydrodexamethasone is a synthetic glucocorticoid and a derivative of dexamethasone, primarily used for its anti-inflammatory and immunosuppressive properties. It is characterized by its structural modifications that enhance its potency and reduce mineralocorticoid activity compared to its parent compound. The substance typically exhibits high solubility in organic solvents and limited solubility in water, which influences its formulation and delivery in pharmaceutical applications. Its mechanism of action involves binding to glucocorticoid receptors, leading to the modulation of gene expression and subsequent biological effects, including the reduction of inflammation and immune response. 11-Dehydrodexamethasone is often utilized in research and clinical settings for conditions such as allergies, autoimmune disorders, and certain types of cancer. Safety and efficacy profiles are well-documented, but like other corticosteroids, it may have side effects, including potential impacts on metabolism and immune function. Proper handling and dosage are essential to minimize adverse effects and maximize therapeutic benefits.
Formula:C22H27FO5
InChI:InChI=1S/C22H27FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-16,24,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,19+,20+,21+,22+/m1/s1
InChI key:InChIKey=RQGQBZQDYVUXCW-RLMYIHAOSA-N
SMILES:F[C@@]12[C@]([C@]3([C@](C)(CC1=O)[C@](C(CO)=O)(O)[C@H](C)C3)[H])(CCC=4[C@]2(C)C=CC(=O)C4)[H]
Synonyms:- Pregna-1,4-diene-3,11,20-trione, 9-fluoro-17,21-dihydroxy-16-methyl-, (16α)-
- 11-Dehydrodexamethasone
- 9-Fluoro-17,21-dihydroxy-16α-methylpregna-1,4-diene-3,11,20-trione
- Pregna-1,4-diene-3,11,20-trione, 9-fluoro-17,21-dihydroxy-16α-methyl-
- (16α)-9-Fluoro-17,21-dihydroxy-16-methylpregna-1,4-diene-3,11,20-trione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
11-Dehydrodexamethasone
CAS:Controlled ProductFormula:C22H27FO5Color and Shape:NeatMolecular weight:390.4452



