CAS 29654-55-5
:3,5-Dihydroxybenzyl alcohol
Description:
3,5-Dihydroxybenzyl alcohol, with the CAS number 29654-55-5, is an organic compound characterized by its aromatic structure featuring two hydroxyl (-OH) groups positioned at the 3 and 5 positions of a benzyl alcohol framework. This compound is a derivative of benzyl alcohol, which contributes to its solubility in polar solvents such as water and alcohols. The presence of hydroxyl groups enhances its reactivity, making it a potential candidate for various chemical reactions, including oxidation and esterification. 3,5-Dihydroxybenzyl alcohol exhibits antioxidant properties, which may be beneficial in pharmaceutical and cosmetic applications. Additionally, its structural features allow it to participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. The compound is of interest in research for its potential biological activities, including anti-inflammatory and antimicrobial effects. Overall, 3,5-Dihydroxybenzyl alcohol is a versatile compound with applications in organic synthesis and potential therapeutic uses.
Formula:C7H8O3
InChI:InChI=1S/C7H8O3/c8-4-5-1-6(9)3-7(10)2-5/h1-3,8-10H,4H2
InChI key:InChIKey=NGYYFWGABVVEPL-UHFFFAOYSA-N
SMILES:c1c(cc(cc1O)O)CO
Synonyms:- 1,3-Benzenediol, 5-(hydroxymethyl)-
- 1,3-Dihydroxy-5-(hydroxymethyl)benzene
- 3,5-Dihydroxybenzenemethanol
- 3,5-Dihydroxybenzylalcohol
- 5-(Hydroxymethyl)-1,3-benzenediol
- 5-(Hydroxymethyl)Benzene-1,3-Diol
- 5-(Hydroxymethyl)resorcinol
- Benzyl alcohol, 3,5-dihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,5-Dihydroxybenzyl Alcohol
CAS:Formula:C7H8O3Purity:>97.0%(GC)Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:140.145-(Hydroxymethyl)-1,3-benzenediol
CAS:Formula:C7H8O3Purity:95%Color and Shape:SolidMolecular weight:140.13663,5-Dihydroxybenzyl alcohol
CAS:Formula:C7H8O3Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white crystalline powder or solidMolecular weight:140.145-(Hydroxymethyl)benzene-1,3-diol
CAS:5-(Hydroxymethyl)benzene-1,3-diolFormula:C7H8O3Purity:98%Color and Shape: beige solidMolecular weight:140.14g/mol3,5-Dihydroxybenzyl alcohol
CAS:3,5-Dihydroxybenzyl alcohol is an organic solution that has been shown to inhibit the growth of cancer cells by binding to the chloride ion and forming a hydrophobic effect with the hydrochloric acid. This compound also inhibits the growth of other cells such as bacteria and yeast. 3,5-Dihydroxybenzyl alcohol has potent inhibitory activity against silver ions and prevents their adhesion to DNA molecules. The molecule also has a hydroxyl group which may help to prevent bacterial growth by preventing the production of proteins essential for cell division. 3,5-Dihydroxybenzyl alcohol is not toxic to human liver cells and does not cause any carcinogenic effects in vitro.
Formula:C7H8O3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:140.14 g/mol5-(Hydroxymethyl)-1,3-benzenediol
CAS:Formula:C7H8O3Purity:97%Color and Shape:Solid, CrystallineMolecular weight:140.138






