CAS 29671-83-8
:Propanoic acid, 2-hydroxy-, 2-hydroxyethyl ester
Description:
Propanoic acid, 2-hydroxy-, 2-hydroxyethyl ester, also known as 2-hydroxyethyl propanoate, is an ester derived from propanoic acid and 2-hydroxyethanol. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is soluble in water and organic solvents, which makes it versatile for various applications. The presence of both hydroxyl and ester functional groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as esterification and transesterification. This compound is often used in the production of surfactants, emulsifiers, and as a solvent in chemical processes. Additionally, it may have applications in the food and cosmetic industries due to its potential as a preservative or fragrance component. Safety data indicates that, like many esters, it should be handled with care, as it may cause irritation to the skin and eyes upon contact. Proper storage and handling protocols are essential to ensure safety during its use.
Formula:C5H10O4
InChI:InChI=1S/C5H10O4/c1-4(7)5(8)9-3-2-6/h4,6-7H,2-3H2,1H3
InChI key:InChIKey=YVOWOLLEVWDWOH-UHFFFAOYSA-N
SMILES:C(C(C)O)(OCCO)=O
Synonyms:- 2-Hydroxyethyl 2-Hydroxypropanoate
- Ethylene glycol, monolactate
- Lactic acid, 2-hydroxyethyl ester
- Propanoic acid, 2-hydroxy-, 2-hydroxyethyl ester
- 2-Hydroxyethyl lactate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Hydroxyethyl 2-hydroxypropanoate
CAS:2-Hydroxyethyl 2-hydroxypropanoate is a polyester that is produced by the dehydration of ethylene glycol and 2-hydroxyethanol. It is a biodegradable, degradable, and regenerative material that can be used in biomedical applications such as scaffolds for tissue engineering. The hydroxy group on the molecule has been shown to prevent protein adhesion and degradation. This product has been shown to inhibit growth of bacteria such as Staphylococcus aureus and Escherichia coli, which may be due to its ability to block the activity of cellular enzymes.
Formula:C5H10O4Purity:Min. 95%Molecular weight:134.13 g/molRef: 3D-EBA67183
Discontinued product
