CAS 29671-92-9
:Chloroformamidine hydrochloride
Description:
Chloroformamidine hydrochloride is a chemical compound characterized by its amidine functional group, which is notable for its basicity and ability to form stable complexes with various substrates. It is typically encountered as a white to off-white crystalline solid and is soluble in water and other polar solvents. The compound is often used in organic synthesis and pharmaceutical applications due to its reactivity and ability to serve as a building block for more complex molecules. Its hydrochloride salt form enhances its stability and solubility, making it easier to handle in laboratory settings. Chloroformamidine hydrochloride may exhibit biological activity, and its derivatives are of interest in medicinal chemistry for potential therapeutic applications. As with many chemical substances, proper safety precautions should be observed when handling it, including the use of personal protective equipment and adherence to relevant safety guidelines.
Formula:CH3ClN2·ClH
InChI:InChI=1S/CH3ClN2.ClH/c2-1(3)4;/h(H3,3,4);1H
InChI key:InChIKey=FUQFHOLPJJETAP-UHFFFAOYSA-N
SMILES:C(Cl)(=N)N.Cl
Synonyms:- 1-Chloroformamidine hydrochloride
- Carbamimidic Chloride
- Carbamimidic Chloride Hydrochloride
- Carbamimidic chloride, monohydrochloride
- Chloroformamidine Hcl
- Chloroformamidine Hydrochloride
- Formamidine, 1-chloro-, monohydrochloride
- Chloroformamidinium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Chloroformamidine Hydrochloride
CAS:Formula:CH3ClN2·HClPurity:>98.0%(T)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:114.96Chloroformamidine hydrochloride
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:114.95999908447266Chloroformamidine hydrochloride
CAS:Chloroformamidine hydrochloridePurity:98%Color and Shape:SolidMolecular weight:114.96g/molChloroformamidineHydrochloride
CAS:ChloroformamidineHydrochloride is an inorganic acid that has a nitrogen atom and a chlorine atom. It is a polymer that is used in the film-forming industry. ChloroformamidineHydrochloride has been shown to be toxicological studies, with tests involving the film forming properties of this molecule. It also has biological properties and can target enzymes such as toll-like receptors and streptococcus faecalis, which are present on the surface of cells. ChloroformamidineHydrochloride can be reacted with creatine to form a molecule called thymidylate, which is needed for DNA synthesis and repair.Formula:CH4Cl2N2Purity:Min. 95%Molecular weight:114.96 g/mol




