CAS 29681-42-3
:Methyl 4-bromopyridine-2-carboxylate
Description:
Methyl 4-bromopyridine-2-carboxylate is an organic compound characterized by its pyridine ring, which is substituted at the 4-position with a bromine atom and at the 2-position with a carboxylate group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It has a molecular formula that reflects the presence of carbon, hydrogen, bromine, and nitrogen atoms, contributing to its unique chemical properties. Methyl 4-bromopyridine-2-carboxylate is known for its reactivity, particularly in nucleophilic substitution reactions, making it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. Its solubility in organic solvents and moderate stability under standard conditions further enhance its utility in chemical synthesis. Additionally, safety precautions should be observed when handling this compound, as it may pose health risks due to the presence of bromine and its potential reactivity.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c1-11-7(10)6-4-5(8)2-3-9-6/h2-4H,1H3
SMILES:COC(=O)c1cc(ccn1)Br
Synonyms:- Methyl 4-Bromopicolinate
- 4-Bromo-pyridine-2-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-bromopyridine-2-carboxylate, 97+%
CAS:It finds its application as a useful synthetic intermediate and in the straightforward and efficient synthesis of 3-benzyloxy-4-bromopicolinate ester and 3-benzyloxy-5-bromopicolinate ester, common building blocks for pharmaceuticals and agrochemicals. It is used in the synthesis of biaryl mannosidFormula:C7H6BrNO2Purity:97+%Color and Shape:Powder, Light cream to creamMolecular weight:216.032-Pyridinecarboxylic acid, 4-bromo-, methyl ester
CAS:Formula:C7H6BrNO2Purity:96%Color and Shape:SolidMolecular weight:216.0320Ref: IN-DA002Z3I
5kgTo inquire10kgTo inquire500gTo inquire250mg20.00€1g22.00€5g31.00€10g50.00€25g75.00€50g117.00€100g164.00€250g537.00€Methyl 4-bromopyridine-2-carboxylate
CAS:Methyl 4-bromopyridine-2-carboxylateFormula:C7H6BrNO2Purity:95%Color and Shape: light brown powderMolecular weight:216.03g/molMethyl 4-bromopicolinate
CAS:Formula:C7H6BrNO2Purity:95%Color and Shape:SolidMolecular weight:216.034Methyl 4-bromopicolinate
CAS:Methyl 4-bromopicolinate is a high quality, reagent and complex compound that is useful as an intermediate for the synthesis of fine chemicals. It is a useful scaffold for the synthesis of other compounds and has been used as a building block for research chemicals. Methyl 4-bromopicolinate is also versatile, being used as a reaction component in the synthesis of pharmaceuticals, agrochemicals, and other compounds.Formula:C7H6BrNO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:216.03 g/mol




