CAS 29681-44-5
:Methyl 5-bromonicotinate
Description:
Methyl 5-bromonicotinate is an organic compound that belongs to the class of nicotinic acid derivatives. It features a bromine atom substituted at the 5-position of the pyridine ring, along with a methyl ester functional group. This compound is typically characterized by its molecular formula, which reflects the presence of carbon, hydrogen, nitrogen, and bromine atoms. Methyl 5-bromonicotinate is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the bromine atom enhances its reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, this compound may exhibit specific physical properties, such as solubility in organic solvents and distinct spectral characteristics in techniques like NMR and IR spectroscopy. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c1-11-7(10)5-2-6(8)4-9-3-5/h2-4H,1H3
SMILES:COC(=O)c1cc(cnc1)Br
Synonyms:- Methyl-5-bromo-3-pyridincarboxylate
- 5-Bromo nicotinic acid methyl ester
- 5-Bromonicotinic Acid Methyl Ester
- Methyl 5-bromopyridine-3-carboxylate
- 5-Bromopyridine-3-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Methyl 5-bromonicotinate, 97%
CAS:Methyl 5-bromonicotinate, 97%, Thermo Scientific ChemicalsFormula:C7H6BrNO2Purity:97%Color and Shape:White, PowderMolecular weight:216.033-Pyridinecarboxylic acid, 5-bromo-, methyl ester
CAS:Formula:C7H6BrNO2Purity:98%Color and Shape:SolidMolecular weight:216.0320Methyl 5-bromonicotinate
CAS:Methyl 5-bromonicotinateFormula:C7H6BrNO2Purity:≥95%Color and Shape: white solidMolecular weight:216.03g/molMethyl 5-Bromonicotinate
CAS:Formula:C7H6BrNO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:216.03Methyl 5-bromopyridine-3-carboxylate
CAS:Formula:C7H6BrNO2Purity:98%Color and Shape:Pink crystalline powderMolecular weight:216.034Methyl 5-bromonicotinate
CAS:Applications Methyl 5-bromonicotinate
Formula:C7H6BrNO2Color and Shape:NeatMolecular weight:216.032






