CAS 296879-33-9

2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N,N-dimethylacetamide

Description:

2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N,N-dimethylacetamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a dimethylacetamide moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are known for their roles in various pharmacological applications. The amino group on the thiadiazole enhances its reactivity and solubility in polar solvents. This compound is likely to exhibit properties such as moderate to high solubility in organic solvents due to the dimethylacetamide component, which is a polar aprotic solvent. Additionally, the presence of the sulfanyl group suggests potential for nucleophilic reactivity. The compound may also display interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Overall, its structural features suggest a versatile compound with potential applications in drug development and other chemical syntheses.

Formula: C₆H₁₀N₄OS₂

InChI: InChI=1/C6H10N4OS2/c1-10(2)4(11)3-12-6-9-8-5(7)13-6/h3H2,1-2H3,(H2,7,8)

SMILES: CN(C)C(=O)CSc1n[nH]c(=N)s1

Synonyms:

• acetamide, 2-[(5-amino-1,3,4-thiadiazol-2-yl)thio]-N,N-dimethyl-

2-[(5-amino-1,3,4-thiadiazol-2-yl)thio]-N,N-dimethylacetamide

CAS: 296879-33-9

Formula: C₆H₁₀N₄OS₂

Molecular weight: 218.2998

Ref: IN-DA002Z3U