CAS 29701-07-3
:D-Streptamine, O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:1)
Description:
D-Streptamine, O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:1) is a complex glycoside with notable structural features that contribute to its biological activity. This compound is characterized by its glycosidic linkages, which involve multiple sugar moieties, specifically deoxy and amino sugars, indicating its potential role in antibiotic activity. The presence of sulfate groups suggests that it may have enhanced solubility and reactivity in biological systems. D-Streptamine is primarily known for its role as a component of certain aminoglycoside antibiotics, which are effective against a range of bacterial infections. Its structure allows for interactions with bacterial ribosomes, inhibiting protein synthesis and thereby exerting its antimicrobial effects. The compound's stereochemistry, particularly the α-configuration of the glucopyranosyl units, is crucial for its biological function. Overall, D-streptamine's unique structural characteristics contribute to its pharmacological properties and its significance in medicinal chemistry.
Formula:C18H37N5O10·H2O4S
InChI:InChI=1S/C18H37N5O10.H2O4S/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18;1-5(2,3)4/h4-18,24-29H,1-3,19-23H2;(H2,1,2,3,4)/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+;/m0./s1
InChI key:InChIKey=YGTPKDKJVZOVCO-KELBJJLKSA-N
SMILES:S(=O)(=O)(O)O.O([C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@@H]1N)[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N
Synonyms:- (1R,2S,3S,4R,6S)-4,6-diamino-3-[(3-amino-3-deoxy-alpha-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-alpha-D-glucopyranoside
- (1R,2S,3S,4R,6S)-4,6-diamino-3-[(3-amino-3-deoxy-alpha-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-alpha-D-glucopyranoside sulfate (1:1)
- (1R,2S,4R,6S)-4,6-diamino-3-[(3-amino-3-deoxy-alpha-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-alpha-D-glucopyranoside
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-3-amino-3-deoxy-α-<smallcap>D</smallcap>-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-<smallcap>D</span>-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:1)
- Aminodeoxykanamycin sulfate
- Bekanamycin Sulfate
- Kanamycin B sulfate salt
- Kanamycin B, sulfate (1:1) (salt)
- Kanendomycin sulfate
- D-Streptamine, O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:1)
- Kanamycin B sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bekanamycin sulfate
CAS:Bekanamycin sulfate is an agent of bioactive chemicals.Formula:C18H39N5O14SPurity:98%Color and Shape:SolidMolecular weight:581.59Kanamycin B Sulfate
CAS:Controlled ProductApplications Antibiotic complex produced by Streptomyces kanamyceticus Okami & Umezawa from Japanese soil. Comprised of three components, kanamycin A, the major component, and kanamycins B and C, two minor congeners. Antibacterial.
References Ito, et al.: J. Antibiot., 17, 189 (1964), Toda, S., et al.: J. Antibiot., 30, 1002 (1977), Claes, P.J., et al.: Anal. Profiles Drug. Subs., 6, 259 (1977),Formula:C18H37N5O10·H2O4SColor and Shape:BeigeMolecular weight:581.59Kanamycin B sulfate
CAS:Kanamycin B sulfate is a growth regulator that inhibits the activity of protein synthesis and DNA synthesis in bacteria. It binds to the 16S ribosomal RNA of bacteria, inhibiting protein synthesis and the production of proteins vital for cell division. Kanamycin B sulfate has been shown to have an inhibitory effect on human immunodeficiency virus type-1 (HIV-1) infection in a model system. The structure of kanamycin B sulfate was determined by powder x-ray diffraction, which showed that it is a crystalline material with a molecular weight of 524.3 Da. Kanamycin B sulfate is also an aminoglycoside antibiotic with anti-viral properties, which can be used as antiviral agents against virus type 1 (HIV).Formula:C18H37N5O10·H2SO4Purity:Min. 95%Molecular weight:581.59 g/mol





