CAS 29703-01-3
:Cesium bicarbonate
Description:
Cesium bicarbonate, with the CAS number 29703-01-3, is an inorganic compound characterized by its composition of cesium, hydrogen, carbon, and oxygen. It typically appears as a white crystalline solid and is highly soluble in water, which makes it useful in various chemical applications. The compound is known for its alkaline properties, as it can release bicarbonate ions in solution, contributing to buffering capacity. Cesium bicarbonate is less common than other alkali metal bicarbonates, such as sodium or potassium bicarbonate, but it is of interest in specialized fields, including analytical chemistry and materials science. Due to the presence of cesium, it exhibits unique properties compared to other bicarbonates, such as higher atomic mass and specific reactivity patterns. Safety considerations are important when handling cesium compounds, as cesium can be reactive and may pose health risks if not managed properly. Overall, cesium bicarbonate serves as a valuable reagent in various chemical processes and research applications.
Formula:CH2CsO3
InChI:InChI=1/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);
InChI key:InChIKey=UHKPOGGUWJGGID-UHFFFAOYSA-N
SMILES:C(=O)(O)O.[Cs]
Synonyms:- Carbonic Acid, Monocesium Salt
- Carbonic acid, cesium salt
- Carbonic acid, cesium salt (1:?)
- Cesium hydrogen carbonate
- Dicaesium Carbonate
- Hydrogen cesium carbonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cesium hydrogen carbonate, 99.99% (metals basis)
CAS:<p>Cesium hydrogen carbonate is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referen</p>Formula:CHCsO3Purity:99.99%Molecular weight:193.92Cesium Bicarbonate
CAS:Cesium BicarbonatePurity:99.99% trace metals basisMolecular weight:193.92g/molCesium hydrogen carbonate, 99.99%
CAS:Formula:CsHCO3Purity:≥ 99.99%Color and Shape:White powder or crystalsMolecular weight:193.92Cesium bicarbonate
CAS:<p>An inorganic cesium salt</p>Formula:CsHCO3Purity:Min. 95%Color and Shape:PowderMolecular weight:193.92 g/mol
