CAS 2971-31-5
:Oxindole-3-acetic acid
Description:
Oxindole-3-acetic acid is an organic compound characterized by its oxindole structure, which consists of a fused indole and a ketone. It is a derivative of indole and features an acetic acid functional group at the 3-position of the oxindole ring. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, reflecting its polar nature due to the presence of the carboxylic acid group. Oxindole-3-acetic acid has garnered interest in various fields, including medicinal chemistry, due to its potential biological activities, such as anti-inflammatory and neuroprotective effects. It may also play a role in plant growth regulation, acting as a phytohormone. The compound's reactivity is influenced by the presence of both the indole and carboxylic acid moieties, allowing for various chemical transformations. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13)
InChI key:InChIKey=ILGMGHZPXRDCCS-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C=2C(NC1=O)=CC=CC2
Synonyms:- 2-Oxo-3-indolineacetic acid
- 3-Indolineacetic acid, 2-oxo-
- Oxindole-3-acetic acid
- 2,3-Dihydro-2-oxo-1H-indole-3-acetic acid
- 1H-Indole-3-acetic acid, 2,3-dihydro-2-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Indole-3-acetic acid, 2,3-dihydro-2-oxo-
CAS:Formula:C10H9NO3Purity:98%Color and Shape:SolidMolecular weight:191.1834(2-Oxo-2,3-dihydro-1H-indol-3-yl)acetic acid
CAS:(2-Oxo-2,3-dihydro-1H-indol-3-yl)acetic acidPurity:99%Molecular weight:191.18g/molOxindole-3-acetic Acid-d4
CAS:Controlled ProductFormula:C10D4H5NO3Color and Shape:NeatMolecular weight:195.208Oxindole-3-acetic Acid
CAS:Controlled ProductFormula:C10H9NO3Color and Shape:NeatMolecular weight:191.182,3-Dihydro-2-oxo-1H-indole-3-aceticacid
CAS:<p>2,3-Dihydro-2-oxo-1H-indole-3-acetic acid is a metabolite of indole acetic acid. It is an inhibitor of indole acetic acid oxidase, which is an enzyme that catalyzes the conversion of indole acetic acid to indoleacetaldehyde. 2,3-Dihydro-2-oxo-1H-indole-3-acetic acid has been shown to be synthesized in vitro by incubating solanum tuberosum and root formation. This compound also inhibits the growth regulator activity of caproic acid in vivo.</p>Formula:C10H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:191.18 g/mol(2-Oxo-2,3-dihydro-1H-indol-3-yl)acetic acid
CAS:Formula:C10H9NO3Purity:98%Color and Shape:SolidMolecular weight:191.186




