CAS 29713-15-3

1,3-Adamantanedicarbonyl dichloride

Description:

1,3-Adamantanedicarbonyl dichloride, with the CAS number 29713-15-3, is a chemical compound characterized by its unique adamantane structure, which consists of a diamond-like cage of carbon atoms. This compound features two carbonyl (C=O) groups, each bonded to a chlorine atom, making it a dichloride derivative. It is typically a solid at room temperature and exhibits a crystalline appearance. The presence of the carbonyl groups contributes to its reactivity, particularly in nucleophilic substitution reactions, making it useful in organic synthesis. The dichloride functionality allows for the introduction of various nucleophiles, facilitating the formation of diverse derivatives. Additionally, 1,3-Adamantanedicarbonyl dichloride is relatively stable under standard conditions but should be handled with care due to its potential reactivity and the toxicity associated with chlorine-containing compounds. Its applications may extend to the synthesis of pharmaceuticals, agrochemicals, and other organic materials, highlighting its significance in chemical research and industry.

Formula: C₁₂H₁₄Cl₂O₂

InChI: InChI=1/C12H14Cl2O2/c13-9(15)11-2-7-1-8(4-11)5-12(3-7,6-11)10(14)16/h7-8H,1-6H2

SMILES: C1C2CC3(CC1CC(C2)(C3)C(=O)Cl)C(=O)Cl

Synonyms:

• Tricyclo[3.3.1.13,7]decane-1,3-dicarbonyl dichloride
• 1,3-Adamantanedicarbonyl chloride
• Tricyclo[3.3.1.1~3,7~]Decane-1,3-Dicarbonyl Dichloride

Tricyclo[3.3.1.13,7]decane-1,3-dicarbonyl dichloride

CAS: 29713-15-3

Formula: C₁₂H₁₄Cl₂O₂

Molecular weight: 261.1444

Ref: IN-DA002Z6U

1,3-Adamantanedicarbonyl chloride

CAS: 29713-15-3

1,3-Adamantanedicarbonyl chloride

Purity: 95%

Molecular weight: 261.15g/mol

Ref: 54-OR1003605

1,3-Adamantanedicarbonylchloride

CAS: 29713-15-3

1,3-Adamantanedicarbonylchloride is a monomer that can be used in anticancer drug development. It is an analog of 1,3-diaminopropane, which has been shown to inhibit the growth of cancer cells and induce their apoptosis. The structure of 1,3-Adamantanedicarbonylchloride has been characterized by NMR spectroscopy under various conditions. The compound reacts with amines to form chlorides and alicyclic compounds. Friedel-Crafts acylation with chloride gives the corresponding carboxylate derivative. This reaction is reversible and can be carried out at room temperature or above.

Formula: C₁₂H₁₄Cl₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 261.14 g/mol

Ref: 3D-FA150824