CAS 2972-78-3
:(2,4-Dimethoxybenzylidene)malononitrile
Description:
(2,4-Dimethoxybenzylidene)malononitrile, with the CAS number 2972-78-3, is an organic compound characterized by its structure, which includes a malononitrile moiety and a benzylidene group substituted with two methoxy groups at the 2 and 4 positions of the aromatic ring. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as a building block in the development of various chemical entities. It exhibits properties such as moderate solubility in organic solvents and may display interesting optical or electronic characteristics due to its conjugated system. The presence of the malononitrile group contributes to its reactivity, making it a candidate for further chemical transformations. Additionally, the methoxy substituents can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. Overall, (2,4-Dimethoxybenzylidene)malononitrile is a versatile compound of interest in both academic research and industrial applications.
Formula:C12H10N2O2
InChI:InChI=1/C12H10N2O2/c1-15-11-4-3-10(12(6-11)16-2)5-9(7-13)8-14/h3-6H,1-2H3
InChI key:InChIKey=VNSYEOGIEARFNL-UHFFFAOYSA-N
SMILES:C(=C(C#N)C#N)C1=C(OC)C=C(OC)C=C1
Synonyms:- (2,4-Dimethoxybenzylidene)malononitrile
- 2-(2,4-Dimethoxy-benzylidene)-malononitrile
- 2-[(2,4-Dimethoxyphenyl)methylene]propanedinitrile
- 2-[(2,4-Dimethoxyphenyl)methylidene]propanedinitrile
- Malononitrile, (2,4-dimethoxybenzylidene)-
- Propanedinitrile, 2-[(2,4-Dimethoxyphenyl)Methylene]-
- Propanedinitrile, [(2,4-dimethoxyphenyl)methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
