
CAS 2972-95-4
:1-Chloro-1,1-dinitroethane
Description:
1-Chloro-1,1-dinitroethane, with the CAS number 2972-95-4, is an organic compound characterized by its unique structure, which includes a chloro group and two nitro groups attached to an ethane backbone. This compound is typically a colorless to pale yellow liquid and is known for its high density and relatively low volatility. It is classified as a nitroalkane, which often exhibits explosive properties, making it of interest in both industrial applications and research. The presence of the nitro groups contributes to its reactivity, particularly in nitration and reduction reactions. Additionally, 1-chloro-1,1-dinitroethane is soluble in organic solvents but has limited solubility in water. Safety precautions are essential when handling this compound due to its potential hazards, including toxicity and explosive characteristics under certain conditions. Its applications may include use as an intermediate in organic synthesis or in the development of energetic materials. Proper storage and handling protocols are crucial to mitigate risks associated with its use.
Formula:C2H3ClN2O4
InChI:InChI=1S/C2H3ClN2O4/c1-2(3,4(6)7)5(8)9/h1H3
InChI key:InChIKey=WCEVKBJRFBEDHR-UHFFFAOYSA-N
SMILES:C(N(=O)=O)(N(=O)=O)(C)Cl
Synonyms:- 1-Chloro-1,1-dinitroethane
- Ethane, 1-chloro-1,1-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
