CAS 29726-60-1
:3-Methyl-1,2,3,4-tetrahydroisoquinoline
Description:
3-Methyl-1,2,3,4-tetrahydroisoquinoline is a bicyclic organic compound that belongs to the class of isoquinolines, which are derived from the isoquinoline structure. This compound features a tetrahydroisoquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a methyl group at the 3-position contributes to its unique chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential biological activities, including effects on the central nervous system, and has been studied for its role in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for various functional group modifications, making it a versatile intermediate in organic synthesis. Additionally, 3-Methyl-1,2,3,4-tetrahydroisoquinoline may exhibit solubility in organic solvents, and its stability can be influenced by environmental factors such as temperature and light.
Formula:C10H13N
InChI:InChI=1/C10H13N/c1-8-6-9-4-2-3-5-10(9)7-11-8/h2-5,8,11H,6-7H2,1H3
SMILES:CC1Cc2ccccc2CN1
Synonyms:- 1,2,3,4-Tetrahydro-3-methylisoquinoline
- Isoquinoline, 1,2,3,4-Tetrahydro-3-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:<p>3-Methyl-1,2,3,4-tetrahydroisoquinoline (3MT) is a chiral compound that can be used as a drug. It has been shown to have affinity for the striatal dopamine receptor and inhibitory potency against the pressor response in rats. 3MT may also be able to reverse tachyphylaxis when administered with selegiline. The toxicities of 3MT are similar to those of other drugs that act on the same receptor, such as atropine and selegiline. 3MT is not active against bacterial infections because it does not disrupt the cell membrane and does not have an effect on the synthesis of proteins.</p>Formula:C10H13NPurity:Min. 95%Molecular weight:147.22 g/mol

