CAS 29727-06-8

trifluoromethanesulfonic acid - 1H-imidazole (1:1)

Description:

Trifluoromethanesulfonic acid - 1H-imidazole (1:1), with the CAS number 29727-06-8, is a chemical compound that combines the strong acid trifluoromethanesulfonic acid (also known as triflic acid) with the organic base 1H-imidazole. This compound exhibits characteristics typical of strong acids, including high acidity and the ability to protonate bases effectively. Triflic acid is known for its stability and non-volatile nature, making it useful in various chemical reactions, particularly in catalysis and as a solvent. The presence of 1H-imidazole, a heterocyclic organic compound, contributes to the overall properties of the mixture, including potential applications in organic synthesis and as a catalyst in various reactions. The combination of these two components can enhance the reactivity and solubility of the resulting compound, making it valuable in both research and industrial applications. Safety precautions are essential when handling this substance due to its corrosive nature and potential health hazards.

Formula: C₄H₅F₃N₂O₃S

InChI: InChI=1/C3H4N2.CHF3O3S/c1-2-5-3-4-1;2-1(3,4)8(5,6)7/h1-3H,(H,4,5);(H,5,6,7)

SMILES: c1c[nH]cn1.C(F)(F)(F)S(=O)(=O)O

1H-Imidazol-3-ium Trifluoromethanesulfonate

CAS: 29727-06-8

Formula: C₄H₅F₃N₂O₃S

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 218.15

Ref: 3B-I1157

Imidazole trifluoromethanesulfonate

CAS: 29727-06-8

Formula: C₄H₅F₃N₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.1543

Ref: IN-DA002Z81

1,1,1-Trifluoro-Methanesulfonic acid compd. With 1H-imidazole (1:1)

CAS: 29727-06-8

1,1,1-Trifluoro-Methanesulfonic acid compd. With 1H-imidazole (1:1)

Purity: 98%

Molecular weight: 218.15g/mol

Ref: 54-PC101710

Methanesulfonic acid, 1,1,1-trifluoro-, compd. with 1H-imidazole (1:1)

CAS: 29727-06-8

Purity: 98%

Molecular weight: 218.1499939

Ref: 10-F862326

Imidazole trifluoromethanesulfonate

CAS: 29727-06-8

Imidazole trifluoromethanesulfonate is a compound that has been used as an ingredient in deionized water. It is also used to treat cardiovascular disorders, psychotic disorders, and metabolic disorders. Imidazole trifluoromethanesulfonate has been shown to reduce the production of hydrogen peroxide in the brain and prevent oxidative damage to DNA. This drug prevents the synthesis of imidazoline, which may be responsible for its effects on blood pressure and heart rate. Imidazole trifluoromethanesulfonate is metabolized by cytochrome P450 enzymes into a protonated form that can bind to viral polymerase and inhibit DNA synthesis. The drug also inhibits hepatitis B virus replication by binding to the NS5B polymerase protein essential for viral RNA synthesis.

Formula: C₄H₅F₃N₂O₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 218.16 g/mol

Ref: 3D-FI82207