CAS 29728-27-6
:Ammonium glycinate
Description:
Ammonium glycinate is an organic compound with the formula C2H6N2O2, characterized by the presence of both ammonium and glycine functional groups. It is a white, crystalline solid that is soluble in water, making it useful in various applications, particularly in biochemistry and pharmaceuticals. As a zwitterionic compound, it possesses both positive and negative charges, which contributes to its stability and solubility in aqueous solutions. Ammonium glycinate is often utilized as a buffering agent, a nutrient source in cell culture media, and as a stabilizer in protein formulations. Its low toxicity and biocompatibility make it suitable for use in biological systems. Additionally, it can participate in various chemical reactions, including those involving amino acids and proteins, due to its functional groups. Overall, ammonium glycinate is valued for its versatility and effectiveness in enhancing the solubility and stability of various compounds in scientific and industrial applications.
Formula:C2H8N2O2
InChI:InChI=1/C2H5NO2.H3N/c3-1-2(4)5;/h1,3H2,(H,4,5);1H3
InChI key:InChIKey=FDIWRLNJDKKDHB-UHFFFAOYSA-N
SMILES:C(CN)(O)=O.N
Synonyms:- 249-813-4
- Ammonium Aminoacetate
- Glycine ammonia salt
- Glycine, Ammonium Salt
- Glycine, ammonium salt (1:1)
- Glycine, monoammonium salt
- Ammonium glycinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
