CAS 2973-17-3
:N-Allylmaleimide
Description:
N-Allylmaleimide is an organic compound characterized by its maleimide structure with an allyl substituent. It is a colorless to pale yellow liquid at room temperature and is known for its reactivity, particularly in Michael addition reactions due to the presence of the maleimide double bond. This compound is soluble in organic solvents such as acetone and dichloromethane but has limited solubility in water. N-Allylmaleimide is often utilized in polymer chemistry, particularly in the synthesis of various copolymers and as a crosslinking agent in the production of thermosetting resins. Its ability to undergo radical polymerization makes it valuable in the development of materials with specific mechanical and thermal properties. Additionally, N-Allylmaleimide can participate in various chemical reactions, including Diels-Alder reactions and other conjugate additions, making it a versatile building block in organic synthesis. Safety precautions should be observed when handling this compound, as it may cause skin and eye irritation.
Formula:C7H7NO2
InChI:InChI=1S/C7H7NO2/c1-2-5-8-6(9)3-4-7(8)10/h2-4H,1,5H2
InChI key:InChIKey=PSFDAYXWBWRTSM-UHFFFAOYSA-N
SMILES:C(C=C)N1C(=O)C=CC1=O
Synonyms:- 1-(2-Propen-1-yl)-1H-pyrrole-2,5-dione
- 1-(2-Propenyl)-1H-pyrrole-2,5-dione
- 1-(Prop-2-en-1-yl)-2,5-dihydro-1H-pyrrole-2,5-dione
- 1-(prop-2-en-1-yl)-1H-pyrrole-2,5-dione
- 1-Allyl-1H-pyrrole-2,5-dione
- 1-Allyl-pyrrole-2,5-dione
- 1-Prop-2-enylpyrrole-2,5-dione
- 1H-Pyrrole-2,5-dione, 1-(2-propen-1-yl)-
- 1H-Pyrrole-2,5-dione, 1-(2-propenyl)-
- Maleimide, N-allyl-
- NSC 177880
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrrole-2,5-dione, 1-(2-propen-1-yl)-
CAS:Formula:C7H7NO2Purity:98%Color and Shape:SolidMolecular weight:137.1360N-Allylmaleimide
CAS:N-Allylmaleimide is an organic chemical that is a reactive monomer. It can be used to form polymers and copolymers with other monomers, including styrene, vinyl acetate, and methyl methacrylate. The polymerization process requires heat and a catalyst such as azobisisobutyronitrile (AIBN). N-Allylmaleimide is also resistant to heat and chloride ions, making it suitable for use in the manufacture of plastic materials that may come into contact with these substances.
Formula:C7H7NO2Purity:Min. 95%Molecular weight:137.14 g/mol



