CAS 29733-70-8
:1,2,4,5-tetrachloro-3-methylbenzene
Description:
1,2,4,5-Tetrachloro-3-methylbenzene, also known as chlorinated aromatic compound, is characterized by its four chlorine atoms and a methyl group attached to a benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is insoluble in water but soluble in organic solvents, which is common for chlorinated hydrocarbons. The presence of multiple chlorine atoms significantly influences its chemical properties, making it more stable and less reactive than non-chlorinated analogs. It exhibits a high density and has a relatively high boiling point due to the strong intermolecular forces associated with chlorine atoms. This compound is often used in industrial applications, including as an intermediate in the synthesis of other chemicals and in various chemical processes. However, it is important to note that chlorinated compounds can pose environmental and health risks, necessitating careful handling and disposal. Safety data sheets should be consulted for specific handling guidelines and potential hazards associated with exposure.
Formula:C7H4Cl4
InChI:InChI=1/C7H4Cl4/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,1H3
SMILES:Cc1c(c(cc(c1Cl)Cl)Cl)Cl
Synonyms:- 2,3,5,6-Tetrachlorotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Tetrachloromethylbenzene
CAS:Tetrachloromethylbenzene is a solvent that belongs to the group of chlorinated hydrocarbons. It is insoluble in water but soluble in organic solvents such as acetone, ether, and benzene. Tetrachloromethylbenzene has high resistance to acids and bases and can be used as a synthetic, proton-donating functional group. The polymerized tetrachloromethylbenzene has been shown to be a good substrate for the formation of polystyrene films. Tetrachloromethylbenzene is also a precursor for sulfonation reactions with styrene monomers, copolymerization reactions with vinylic monomers, and nucleophilic substitution reactions with electrophilic substrates.Formula:C7H4Cl4Purity:Min. 95%Molecular weight:229.92 g/mol
